C23H25N3O5S — CID 59735907
2-[[3-(2-phenylmethoxyethylamino)-5-propan-2-yloxybenzoyl]amino]-1,3-thiazole-5-carboxylic acid (PubChem CID 59735907) has the molecular formula C23H25N3O5S and a molecular weight of 455.54 g/mol. Its IUPAC name is 2-[[3-(2-phenylmethoxyethylamino)-5-propan-2-yloxybenzoyl]amino]-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-[[3-(2-phenylmethoxyethylamino)-5-propan-2-yloxybenzoyl]amino]-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 59735907 |
| Molecular Formula | C23H25N3O5S |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | 2-[[3-(2-phenylmethoxyethylamino)-5-propan-2-yloxybenzoyl]amino]-1,3-thiazole-5-carboxylic acid |
| SMILES | CC(C)Oc1cc(NCCOCc2ccccc2)cc(C(=O)Nc2ncc(C(=O)O)s2)c1 |
| InChI | InChI=1S/C23H25N3O5S/c1-15(2)31-19-11-17(21(27)26-23-25-13-20(32-23)22(28)29)10-18(12-19)24-8-9-30-14-16-6-4-3-5-7-16/h3-7,10-13,15,24H,8-9,14H2,1-2H3,(H,28,29)(H,25,26,27) |
| InChIKey | XGXIIYGEMIAFAL-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 109.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|