C22H21N3O5S — CID 53308260
3-(3-methoxypropoxy)-5-[(E)-2-(2-nitrophenyl)ethenyl]-N-(1,3-thiazol-2-yl)benzamide (PubChem CID 53308260) has the molecular formula C22H21N3O5S and a molecular weight of 439.49 g/mol. Its IUPAC name is 3-(3-methoxypropoxy)-5-[(E)-2-(2-nitrophenyl)ethenyl]-N-(1,3-thiazol-2-yl)benzamide.
| Compound Name | 3-(3-methoxypropoxy)-5-[(E)-2-(2-nitrophenyl)ethenyl]-N-(1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 53308260 |
| Molecular Formula | C22H21N3O5S |
| Molecular Weight | 439.49 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | 3-(3-methoxypropoxy)-5-[(E)-2-(2-nitrophenyl)ethenyl]-N-(1,3-thiazol-2-yl)benzamide |
| SMILES | COCCCOc1cc(/C=C/c2ccccc2[N+](=O)[O-])cc(C(=O)Nc2nccs2)c1 |
| InChI | InChI=1S/C22H21N3O5S/c1-29-10-4-11-30-19-14-16(7-8-17-5-2-3-6-20(17)25(27)28)13-18(15-19)21(26)24-22-23-9-12-31-22/h2-3,5-9,12-15H,4,10-11H2,1H3,(H,23,24,26)/b8-7+ |
| InChIKey | TXBZOXBSZWLOJN-BQYQJAHWSA-N |
| XLogP | 4.89 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.49 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|