C23H27N3O5S2 — CID 53307866
3-[2-[2-(methanesulfonamido)phenyl]ethyl]-5-(3-methoxypropoxy)-N-(1,3-thiazol-2-yl)benzamide (PubChem CID 53307866) has the molecular formula C23H27N3O5S2 and a molecular weight of 489.62 g/mol. Its IUPAC name is 3-[2-[2-(methanesulfonamido)phenyl]ethyl]-5-(3-methoxypropoxy)-N-(1,3-thiazol-2-yl)benzamide.
| Compound Name | 3-[2-[2-(methanesulfonamido)phenyl]ethyl]-5-(3-methoxypropoxy)-N-(1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 53307866 |
| Molecular Formula | C23H27N3O5S2 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | 3-[2-[2-(methanesulfonamido)phenyl]ethyl]-5-(3-methoxypropoxy)-N-(1,3-thiazol-2-yl)benzamide |
| SMILES | COCCCOc1cc(CCc2ccccc2NS(C)(=O)=O)cc(C(=O)Nc2nccs2)c1 |
| InChI | InChI=1S/C23H27N3O5S2/c1-30-11-5-12-31-20-15-17(14-19(16-20)22(27)25-23-24-10-13-32-23)8-9-18-6-3-4-7-21(18)26-33(2,28)29/h3-4,6-7,10,13-16,26H,5,8-9,11-12H2,1-2H3,(H,24,25,27) |
| InChIKey | YDCMVXMHXFMPKT-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|