C23H21F2N3O3 — CID 67307262
3-[(E)-2-(2,6-difluorophenyl)ethenyl]-5-(3-methoxypropoxy)-N-pyrazin-2-ylbenzamide (PubChem CID 67307262) has the molecular formula C23H21F2N3O3 and a molecular weight of 425.44 g/mol. Its IUPAC name is 3-[(E)-2-(2,6-difluorophenyl)ethenyl]-5-(3-methoxypropoxy)-N-pyrazin-2-ylbenzamide.
| Compound Name | 3-[(E)-2-(2,6-difluorophenyl)ethenyl]-5-(3-methoxypropoxy)-N-pyrazin-2-ylbenzamide |
|---|---|
| PubChem CID | 67307262 |
| Molecular Formula | C23H21F2N3O3 |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | 3-[(E)-2-(2,6-difluorophenyl)ethenyl]-5-(3-methoxypropoxy)-N-pyrazin-2-ylbenzamide |
| SMILES | COCCCOc1cc(/C=C/c2c(F)cccc2F)cc(C(=O)Nc2cnccn2)c1 |
| InChI | InChI=1S/C23H21F2N3O3/c1-30-10-3-11-31-18-13-16(6-7-19-20(24)4-2-5-21(19)25)12-17(14-18)23(29)28-22-15-26-8-9-27-22/h2,4-9,12-15H,3,10-11H2,1H3,(H,27,28,29)/b7-6+ |
| InChIKey | IFRLNHROEDPIIH-VOTSOKGWSA-N |
| XLogP | 4.59 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|