C25H34N4O2 — CID 58135278
2-(N-[2-[1,3-dihydroisoindol-2-yl(methyl)amino]-2-oxoethyl]anilino)-N-(4-methylpentyl)acetamide (PubChem CID 58135278) has the molecular formula C25H34N4O2 and a molecular weight of 422.57 g/mol. Its IUPAC name is 2-(N-[2-[1,3-dihydroisoindol-2-yl(methyl)amino]-2-oxoethyl]anilino)-N-(4-methylpentyl)acetamide.
| Compound Name | 2-(N-[2-[1,3-dihydroisoindol-2-yl(methyl)amino]-2-oxoethyl]anilino)-N-(4-methylpentyl)acetamide |
|---|---|
| PubChem CID | 58135278 |
| Molecular Formula | C25H34N4O2 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | 2-(N-[2-[1,3-dihydroisoindol-2-yl(methyl)amino]-2-oxoethyl]anilino)-N-(4-methylpentyl)acetamide |
| SMILES | CC(C)CCCNC(=O)CN(CC(=O)N(C)N1Cc2ccccc2C1)c1ccccc1 |
| InChI | InChI=1S/C25H34N4O2/c1-20(2)10-9-15-26-24(30)18-28(23-13-5-4-6-14-23)19-25(31)27(3)29-16-21-11-7-8-12-22(21)17-29/h4-8,11-14,20H,9-10,15-19H2,1-3H3,(H,26,30) |
| InChIKey | HWMHHJXFJQXAOS-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|