C29H44N6O3 — CID 58135282
2-[N-[2-[1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl(methyl)amino]-2-oxoethyl]-2-methyl-5-(5-methyl-1,2,4-oxadiazol-3-yl)anilino]-N-(4-methylpentyl)acetamide (PubChem CID 58135282) has the molecular formula C29H44N6O3 and a molecular weight of 524.71 g/mol. Its IUPAC name is 2-[N-[2-[1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl(methyl)amino]-2-oxoethyl]-2-methyl-5-(5-methyl-1,2,4-oxadiazol-3-yl)anilino]-N-(4-methylpentyl)acetamide.
| Compound Name | 2-[N-[2-[1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl(methyl)amino]-2-oxoethyl]-2-methyl-5-(5-methyl-1,2,4-oxadiazol-3-yl)anilino]-N-(4-methylpentyl)acetamide |
|---|---|
| PubChem CID | 58135282 |
| Molecular Formula | C29H44N6O3 |
| Molecular Weight | 524.71 g/mol |
| Exact Mass | 524.35 |
| IUPAC Name | 2-[N-[2-[1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl(methyl)amino]-2-oxoethyl]-2-methyl-5-(5-methyl-1,2,4-oxadiazol-3-yl)anilino]-N-(4-methylpentyl)acetamide |
| SMILES | Cc1nc(-c2ccc(C)c(N(CC(=O)NCCCC(C)C)CC(=O)N(C)N3CC4CCCCC4C3)c2)no1 |
| InChI | InChI=1S/C29H44N6O3/c1-20(2)9-8-14-30-27(36)18-34(26-15-23(13-12-21(26)3)29-31-22(4)38-32-29)19-28(37)33(5)35-16-24-10-6-7-11-25(24)17-35/h12-13,15,20,24-25H,6-11,14,16-19H2,1-5H3,(H,30,36) |
| InChIKey | JUHDZMHABRPFRQ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 94.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.71 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|