C20H34N4O4 — CID 58135851
3-(2-oxopiperidin-1-yl)propyl 2-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]-2-oxoacetate (PubChem CID 58135851) has the molecular formula C20H34N4O4 and a molecular weight of 394.52 g/mol. Its IUPAC name is 3-(2-oxopiperidin-1-yl)propyl 2-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]-2-oxoacetate.
| Compound Name | 3-(2-oxopiperidin-1-yl)propyl 2-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 58135851 |
| Molecular Formula | C20H34N4O4 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.26 |
| IUPAC Name | 3-(2-oxopiperidin-1-yl)propyl 2-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]-2-oxoacetate |
| SMILES | CN1CCC(N2CCN(C(=O)C(=O)OCCCN3CCCCC3=O)CC2)CC1 |
| InChI | InChI=1S/C20H34N4O4/c1-21-10-6-17(7-11-21)22-12-14-24(15-13-22)19(26)20(27)28-16-4-9-23-8-3-2-5-18(23)25/h17H,2-16H2,1H3 |
| InChIKey | ZBCMCEMPKMSDQN-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 73.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|