C17H32N4O3 — CID 58135830
[2-(dimethylamino)-2-oxoethyl] 3-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]propanoate (PubChem CID 58135830) has the molecular formula C17H32N4O3 and a molecular weight of 340.47 g/mol. Its IUPAC name is [2-(dimethylamino)-2-oxoethyl] 3-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]propanoate.
| Compound Name | [2-(dimethylamino)-2-oxoethyl] 3-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]propanoate |
|---|---|
| PubChem CID | 58135830 |
| Molecular Formula | C17H32N4O3 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.25 |
| IUPAC Name | [2-(dimethylamino)-2-oxoethyl] 3-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]propanoate |
| SMILES | CN1CCN(C2CCN(CCC(=O)OCC(=O)N(C)C)CC2)CC1 |
| InChI | InChI=1S/C17H32N4O3/c1-18(2)16(22)14-24-17(23)6-9-20-7-4-15(5-8-20)21-12-10-19(3)11-13-21/h15H,4-14H2,1-3H3 |
| InChIKey | UCMBYSKRQNRMQH-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 56.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |