C15H18BrFO2 — CID 58136309
tert-butyl 1-[(5-bromo-2-fluorophenyl)methyl]cyclopropane-1-carboxylate (PubChem CID 58136309) has the molecular formula C15H18BrFO2 and a molecular weight of 329.21 g/mol. Its IUPAC name is tert-butyl 1-[(5-bromo-2-fluorophenyl)methyl]cyclopropane-1-carboxylate.
| Compound Name | tert-butyl 1-[(5-bromo-2-fluorophenyl)methyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 58136309 |
| Molecular Formula | C15H18BrFO2 |
| Molecular Weight | 329.21 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | tert-butyl 1-[(5-bromo-2-fluorophenyl)methyl]cyclopropane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1(Cc2cc(Br)ccc2F)CC1 |
| InChI | InChI=1S/C15H18BrFO2/c1-14(2,3)19-13(18)15(6-7-15)9-10-8-11(16)4-5-12(10)17/h4-5,8H,6-7,9H2,1-3H3 |
| InChIKey | UPUARWBGWLARPI-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.21 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |