C18H26BrFO — CID 66026576
[1-[(5-bromo-2-fluorophenyl)methyl]-4-tert-butylcyclohexyl]methanol (PubChem CID 66026576) has the molecular formula C18H26BrFO and a molecular weight of 357.31 g/mol. Its IUPAC name is [1-[(5-bromo-2-fluorophenyl)methyl]-4-tert-butylcyclohexyl]methanol.
| Compound Name | [1-[(5-bromo-2-fluorophenyl)methyl]-4-tert-butylcyclohexyl]methanol |
|---|---|
| PubChem CID | 66026576 |
| Molecular Formula | C18H26BrFO |
| Molecular Weight | 357.31 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | [1-[(5-bromo-2-fluorophenyl)methyl]-4-tert-butylcyclohexyl]methanol |
| SMILES | CC(C)(C)C1CCC(CO)(Cc2cc(Br)ccc2F)CC1 |
| InChI | InChI=1S/C18H26BrFO/c1-17(2,3)14-6-8-18(12-21,9-7-14)11-13-10-15(19)4-5-16(13)20/h4-5,10,14,21H,6-9,11-12H2,1-3H3 |
| InChIKey | QZIWZOOACRXTBB-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.31 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |