C8H17N3O2 — CID 58137843
N-methoxy-N,1-dimethylpiperazine-2-carboxamide (PubChem CID 58137843) has the molecular formula C8H17N3O2 and a molecular weight of 187.24 g/mol. Its IUPAC name is N-methoxy-N,1-dimethylpiperazine-2-carboxamide.
| Compound Name | N-methoxy-N,1-dimethylpiperazine-2-carboxamide |
|---|---|
| PubChem CID | 58137843 |
| Molecular Formula | C8H17N3O2 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.13 |
| IUPAC Name | N-methoxy-N,1-dimethylpiperazine-2-carboxamide |
| SMILES | CON(C)C(=O)C1CNCCN1C |
| InChI | InChI=1S/C8H17N3O2/c1-10-5-4-9-6-7(10)8(12)11(2)13-3/h7,9H,4-6H2,1-3H3 |
| InChIKey | DLJOGOXXANMOMR-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|