C8H16N2O2 — CID 174500451
methyl 4-methyl-1,4-diazepane-5-carboxylate (PubChem CID 174500451) has the molecular formula C8H16N2O2 and a molecular weight of 172.23 g/mol. Its IUPAC name is methyl 4-methyl-1,4-diazepane-5-carboxylate.
| Compound Name | methyl 4-methyl-1,4-diazepane-5-carboxylate |
|---|---|
| PubChem CID | 174500451 |
| Molecular Formula | C8H16N2O2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.12 |
| IUPAC Name | methyl 4-methyl-1,4-diazepane-5-carboxylate |
| SMILES | COC(=O)C1CCNCCN1C |
| InChI | InChI=1S/C8H16N2O2/c1-10-6-5-9-4-3-7(10)8(11)12-2/h7,9H,3-6H2,1-2H3 |
| InChIKey | MOZWIEFVHNXXDM-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |