C27H28FNO5 — CID 58138125
2-[4-[6-[3-(2-fluorophenyl)-2-oxopropyl]-3,4-dihydro-1H-isoquinoline-2-carbonyl]oxycyclohexylidene]acetic acid (PubChem CID 58138125) has the molecular formula C27H28FNO5 and a molecular weight of 465.52 g/mol. Its IUPAC name is 2-[4-[6-[3-(2-fluorophenyl)-2-oxopropyl]-3,4-dihydro-1H-isoquinoline-2-carbonyl]oxycyclohexylidene]acetic acid.
| Compound Name | 2-[4-[6-[3-(2-fluorophenyl)-2-oxopropyl]-3,4-dihydro-1H-isoquinoline-2-carbonyl]oxycyclohexylidene]acetic acid |
|---|---|
| PubChem CID | 58138125 |
| Molecular Formula | C27H28FNO5 |
| Molecular Weight | 465.52 g/mol |
| Exact Mass | 465.20 |
| IUPAC Name | 2-[4-[6-[3-(2-fluorophenyl)-2-oxopropyl]-3,4-dihydro-1H-isoquinoline-2-carbonyl]oxycyclohexylidene]acetic acid |
| SMILES | O=C(O)C=C1CCC(OC(=O)N2CCc3cc(CC(=O)Cc4ccccc4F)ccc3C2)CC1 |
| InChI | InChI=1S/C27H28FNO5/c28-25-4-2-1-3-21(25)16-23(30)14-19-5-8-22-17-29(12-11-20(22)13-19)27(33)34-24-9-6-18(7-10-24)15-26(31)32/h1-5,8,13,15,24H,6-7,9-12,14,16-17H2,(H,31,32)/b18-15- |
| InChIKey | RCMJOYOXFKCQQZ-SDXDJHTJSA-N |
| XLogP | 4.63 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.52 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|