C22H15FN4O — CID 58138813
N-[(6-ethynyl-3-pyridinyl)methyl]-1-(4-fluorophenyl)indazole-4-carboxamide (PubChem CID 58138813) has the molecular formula C22H15FN4O and a molecular weight of 370.39 g/mol. Its IUPAC name is N-[(6-ethynyl-3-pyridinyl)methyl]-1-(4-fluorophenyl)indazole-4-carboxamide.
| Compound Name | N-[(6-ethynyl-3-pyridinyl)methyl]-1-(4-fluorophenyl)indazole-4-carboxamide |
|---|---|
| PubChem CID | 58138813 |
| Molecular Formula | C22H15FN4O |
| Molecular Weight | 370.39 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | N-[(6-ethynyl-3-pyridinyl)methyl]-1-(4-fluorophenyl)indazole-4-carboxamide |
| SMILES | C#Cc1ccc(CNC(=O)c2cccc3c2cnn3-c2ccc(F)cc2)cn1 |
| InChI | InChI=1S/C22H15FN4O/c1-2-17-9-6-15(12-24-17)13-25-22(28)19-4-3-5-21-20(19)14-26-27(21)18-10-7-16(23)8-11-18/h1,3-12,14H,13H2,(H,25,28) |
| InChIKey | GUWUWAOJMMNQTJ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.39 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|