C21H17FN4O — CID 143887698
4-[[1-[1-(4-fluorophenyl)indazol-4-yl]ethenylamino]methyl]-1H-pyridin-2-one (PubChem CID 143887698) has the molecular formula C21H17FN4O and a molecular weight of 360.39 g/mol. Its IUPAC name is 4-[[1-[1-(4-fluorophenyl)indazol-4-yl]ethenylamino]methyl]-1H-pyridin-2-one.
| Compound Name | 4-[[1-[1-(4-fluorophenyl)indazol-4-yl]ethenylamino]methyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 143887698 |
| Molecular Formula | C21H17FN4O |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 4-[[1-[1-(4-fluorophenyl)indazol-4-yl]ethenylamino]methyl]-1H-pyridin-2-one |
| SMILES | C=C(NCc1cc[nH]c(=O)c1)c1cccc2c1cnn2-c1ccc(F)cc1 |
| InChI | InChI=1S/C21H17FN4O/c1-14(24-12-15-9-10-23-21(27)11-15)18-3-2-4-20-19(18)13-25-26(20)17-7-5-16(22)6-8-17/h2-11,13,24H,1,12H2,(H,23,27) |
| InChIKey | MPDGHFPGGIHYNK-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |