C22H15BrFN5 — CID 143887690
4-[1-[(6-bromo-3-pyridinyl)methylamino]ethenyl]-1-(4-fluorophenyl)indazole-6-carbonitrile (PubChem CID 143887690) has the molecular formula C22H15BrFN5 and a molecular weight of 448.30 g/mol. Its IUPAC name is 4-[1-[(6-bromo-3-pyridinyl)methylamino]ethenyl]-1-(4-fluorophenyl)indazole-6-carbonitrile.
| Compound Name | 4-[1-[(6-bromo-3-pyridinyl)methylamino]ethenyl]-1-(4-fluorophenyl)indazole-6-carbonitrile |
|---|---|
| PubChem CID | 143887690 |
| Molecular Formula | C22H15BrFN5 |
| Molecular Weight | 448.30 g/mol |
| Exact Mass | 447.05 |
| IUPAC Name | 4-[1-[(6-bromo-3-pyridinyl)methylamino]ethenyl]-1-(4-fluorophenyl)indazole-6-carbonitrile |
| SMILES | C=C(NCc1ccc(Br)nc1)c1cc(C#N)cc2c1cnn2-c1ccc(F)cc1 |
| InChI | InChI=1S/C22H15BrFN5/c1-14(26-11-15-2-7-22(23)27-12-15)19-8-16(10-25)9-21-20(19)13-28-29(21)18-5-3-17(24)4-6-18/h2-9,12-13,26H,1,11H2 |
| InChIKey | FIQKHTAXSYZQBN-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 66.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.30 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|