C16H12BrFN2O — CID 143887624
6-bromo-1-(4-fluorophenyl)-4-(1-methoxyethenyl)indazole (PubChem CID 143887624) has the molecular formula C16H12BrFN2O and a molecular weight of 347.19 g/mol. Its IUPAC name is 6-bromo-1-(4-fluorophenyl)-4-(1-methoxyethenyl)indazole.
| Compound Name | 6-bromo-1-(4-fluorophenyl)-4-(1-methoxyethenyl)indazole |
|---|---|
| PubChem CID | 143887624 |
| Molecular Formula | C16H12BrFN2O |
| Molecular Weight | 347.19 g/mol |
| Exact Mass | 346.01 |
| IUPAC Name | 6-bromo-1-(4-fluorophenyl)-4-(1-methoxyethenyl)indazole |
| SMILES | C=C(OC)c1cc(Br)cc2c1cnn2-c1ccc(F)cc1 |
| InChI | InChI=1S/C16H12BrFN2O/c1-10(21-2)14-7-11(17)8-16-15(14)9-19-20(16)13-5-3-12(18)4-6-13/h3-9H,1H2,2H3 |
| InChIKey | MISLLBWYHDSRPV-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.19 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|