C21H25FN4O2 — CID 143887581
(Z)-2-[3-(dimethylamino)propylamino]-2-[1-(4-fluorophenyl)indazol-4-yl]ethenol;formaldehyde (PubChem CID 143887581) has the molecular formula C21H25FN4O2 and a molecular weight of 384.46 g/mol. Its IUPAC name is (Z)-2-[3-(dimethylamino)propylamino]-2-[1-(4-fluorophenyl)indazol-4-yl]ethenol;formaldehyde.
| Compound Name | (Z)-2-[3-(dimethylamino)propylamino]-2-[1-(4-fluorophenyl)indazol-4-yl]ethenol;formaldehyde |
|---|---|
| PubChem CID | 143887581 |
| Molecular Formula | C21H25FN4O2 |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | (Z)-2-[3-(dimethylamino)propylamino]-2-[1-(4-fluorophenyl)indazol-4-yl]ethenol;formaldehyde |
| SMILES | C=O.CN(C)CCCN/C(=C\O)c1cccc2c1cnn2-c1ccc(F)cc1 |
| InChI | InChI=1S/C20H23FN4O.CH2O/c1-24(2)12-4-11-22-19(14-26)17-5-3-6-20-18(17)13-23-25(20)16-9-7-15(21)8-10-16;1-2/h3,5-10,13-14,22,26H,4,11-12H2,1-2H3;1H2/b19-14-; |
| InChIKey | VVZYMIINCBBHQV-YEBWQKSTSA-N |
| XLogP | 3.38 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|