C9H16BN2O3 — CID 58140288
CID 58140288 (PubChem CID 58140288) has the molecular formula C9H16BN2O3 and a molecular weight of 211.05 g/mol.
| Compound Name | CID 58140288 |
|---|---|
| PubChem CID | 58140288 |
| Molecular Formula | C9H16BN2O3 |
| Molecular Weight | 211.05 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | — |
| SMILES | NC(=O)C(O)C(CC1CCC1)N[B]C=O |
| InChI | InChI=1S/C9H16BN2O3/c11-9(15)8(14)7(12-10-5-13)4-6-2-1-3-6/h5-8,12,14H,1-4H2,(H2,11,15) |
| InChIKey | FTKXICPFDWVCOT-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.05 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|