C16H27N3O2+2 — CID 58140535
2-[1-[5-[3-(2-hydroxyethyl)imidazol-1-ium-1-yl]pentyl]-3H-pyrrol-1-ium-3-yl]ethanol (PubChem CID 58140535) has the molecular formula C16H27N3O2+2 and a molecular weight of 293.41 g/mol. Its IUPAC name is 2-[1-[5-[3-(2-hydroxyethyl)imidazol-1-ium-1-yl]pentyl]-3H-pyrrol-1-ium-3-yl]ethanol.
| Compound Name | 2-[1-[5-[3-(2-hydroxyethyl)imidazol-1-ium-1-yl]pentyl]-3H-pyrrol-1-ium-3-yl]ethanol |
|---|---|
| PubChem CID | 58140535 |
| Molecular Formula | C16H27N3O2+2 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | 2-[1-[5-[3-(2-hydroxyethyl)imidazol-1-ium-1-yl]pentyl]-3H-pyrrol-1-ium-3-yl]ethanol |
| SMILES | OCCC1C=C[N+](CCCCC[n+]2ccn(CCO)c2)=C1 |
| InChI | InChI=1S/C16H27N3O2/c20-12-5-16-4-8-17(14-16)6-2-1-3-7-18-9-10-19(15-18)11-13-21/h4,8-10,14-16,20-21H,1-3,5-7,11-13H2/q+2 |
| InChIKey | JSCFDRODBSXTFQ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 52.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|