C27H29F3N2O5S — CID 58143705
5-[2-[4-(tert-butylsulfonylmethyl)piperidin-1-yl]-2-oxoethyl]-2-[4-(trifluoromethyl)phenyl]isoindole-1,3-dione (PubChem CID 58143705) has the molecular formula C27H29F3N2O5S and a molecular weight of 550.60 g/mol. Its IUPAC name is 5-[2-[4-(tert-butylsulfonylmethyl)piperidin-1-yl]-2-oxoethyl]-2-[4-(trifluoromethyl)phenyl]isoindole-1,3-dione.
| Compound Name | 5-[2-[4-(tert-butylsulfonylmethyl)piperidin-1-yl]-2-oxoethyl]-2-[4-(trifluoromethyl)phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 58143705 |
| Molecular Formula | C27H29F3N2O5S |
| Molecular Weight | 550.60 g/mol |
| Exact Mass | 550.17 |
| IUPAC Name | 5-[2-[4-(tert-butylsulfonylmethyl)piperidin-1-yl]-2-oxoethyl]-2-[4-(trifluoromethyl)phenyl]isoindole-1,3-dione |
| SMILES | CC(C)(C)S(=O)(=O)CC1CCN(C(=O)Cc2ccc3c(c2)C(=O)N(c2ccc(C(F)(F)F)cc2)C3=O)CC1 |
| InChI | InChI=1S/C27H29F3N2O5S/c1-26(2,3)38(36,37)16-17-10-12-31(13-11-17)23(33)15-18-4-9-21-22(14-18)25(35)32(24(21)34)20-7-5-19(6-8-20)27(28,29)30/h4-9,14,17H,10-13,15-16H2,1-3H3 |
| InChIKey | FCOVHXQVRHFSLF-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.60 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|