C23H21N3O3 — CID 58146158
2-methyl-7-(4-methylphenoxy)-N-(5-methyl-2-pyridinyl)-3-oxo-1H-isoindole-5-carboxamide (PubChem CID 58146158) has the molecular formula C23H21N3O3 and a molecular weight of 387.44 g/mol. Its IUPAC name is 2-methyl-7-(4-methylphenoxy)-N-(5-methyl-2-pyridinyl)-3-oxo-1H-isoindole-5-carboxamide.
| Compound Name | 2-methyl-7-(4-methylphenoxy)-N-(5-methyl-2-pyridinyl)-3-oxo-1H-isoindole-5-carboxamide |
|---|---|
| PubChem CID | 58146158 |
| Molecular Formula | C23H21N3O3 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | 2-methyl-7-(4-methylphenoxy)-N-(5-methyl-2-pyridinyl)-3-oxo-1H-isoindole-5-carboxamide |
| SMILES | Cc1ccc(Oc2cc(C(=O)Nc3ccc(C)cn3)cc3c2CN(C)C3=O)cc1 |
| InChI | InChI=1S/C23H21N3O3/c1-14-4-7-17(8-5-14)29-20-11-16(10-18-19(20)13-26(3)23(18)28)22(27)25-21-9-6-15(2)12-24-21/h4-12H,13H2,1-3H3,(H,24,25,27) |
| InChIKey | GJEDNQLNQOHQMN-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |