C25H25N3O6S — CID 90721975
3-hydroxy-2-(2-methoxyethyl)-7-(4-methylperoxysulfanylphenoxy)-N-(5-methyl-2-pyridinyl)isoindole-5-carboxamide (PubChem CID 90721975) has the molecular formula C25H25N3O6S and a molecular weight of 495.56 g/mol. Its IUPAC name is 3-hydroxy-2-(2-methoxyethyl)-7-(4-methylperoxysulfanylphenoxy)-N-(5-methyl-2-pyridinyl)isoindole-5-carboxamide.
| Compound Name | 3-hydroxy-2-(2-methoxyethyl)-7-(4-methylperoxysulfanylphenoxy)-N-(5-methyl-2-pyridinyl)isoindole-5-carboxamide |
|---|---|
| PubChem CID | 90721975 |
| Molecular Formula | C25H25N3O6S |
| Molecular Weight | 495.56 g/mol |
| Exact Mass | 495.15 |
| IUPAC Name | 3-hydroxy-2-(2-methoxyethyl)-7-(4-methylperoxysulfanylphenoxy)-N-(5-methyl-2-pyridinyl)isoindole-5-carboxamide |
| SMILES | COCCn1cc2c(Oc3ccc(SOOC)cc3)cc(C(=O)Nc3ccc(C)cn3)cc2c1O |
| InChI | InChI=1S/C25H25N3O6S/c1-16-4-9-23(26-14-16)27-24(29)17-12-20-21(15-28(25(20)30)10-11-31-2)22(13-17)33-18-5-7-19(8-6-18)35-34-32-3/h4-9,12-15,30H,10-11H2,1-3H3,(H,26,27,29) |
| InChIKey | ATQFDZMCGMEPRI-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 104.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.56 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|