C27H24N4O5S — CID 59559845
2-[(2-methylimidazol-1-yl)methyl]-4-(4-methylperoxysulfanylphenoxy)-N-(5-methyl-2-pyridinyl)-1-benzofuran-6-carboxamide (PubChem CID 59559845) has the molecular formula C27H24N4O5S and a molecular weight of 516.58 g/mol. Its IUPAC name is 2-[(2-methylimidazol-1-yl)methyl]-4-(4-methylperoxysulfanylphenoxy)-N-(5-methyl-2-pyridinyl)-1-benzofuran-6-carboxamide.
| Compound Name | 2-[(2-methylimidazol-1-yl)methyl]-4-(4-methylperoxysulfanylphenoxy)-N-(5-methyl-2-pyridinyl)-1-benzofuran-6-carboxamide |
|---|---|
| PubChem CID | 59559845 |
| Molecular Formula | C27H24N4O5S |
| Molecular Weight | 516.58 g/mol |
| Exact Mass | 516.15 |
| IUPAC Name | 2-[(2-methylimidazol-1-yl)methyl]-4-(4-methylperoxysulfanylphenoxy)-N-(5-methyl-2-pyridinyl)-1-benzofuran-6-carboxamide |
| SMILES | COOSc1ccc(Oc2cc(C(=O)Nc3ccc(C)cn3)cc3oc(Cn4ccnc4C)cc23)cc1 |
| InChI | InChI=1S/C27H24N4O5S/c1-17-4-9-26(29-15-17)30-27(32)19-12-24(34-20-5-7-22(8-6-20)37-36-33-3)23-14-21(35-25(23)13-19)16-31-11-10-28-18(31)2/h4-15H,16H2,1-3H3,(H,29,30,32) |
| InChIKey | OMVZCMWWENCYEL-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 100.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.58 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|