C20H17N3O5S — CID 59560300
4-(4-methylperoxysulfanylphenoxy)-N-(1-methylpyrazol-3-yl)-1-benzofuran-6-carboxamide (PubChem CID 59560300) has the molecular formula C20H17N3O5S and a molecular weight of 411.44 g/mol. Its IUPAC name is 4-(4-methylperoxysulfanylphenoxy)-N-(1-methylpyrazol-3-yl)-1-benzofuran-6-carboxamide.
| Compound Name | 4-(4-methylperoxysulfanylphenoxy)-N-(1-methylpyrazol-3-yl)-1-benzofuran-6-carboxamide |
|---|---|
| PubChem CID | 59560300 |
| Molecular Formula | C20H17N3O5S |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | 4-(4-methylperoxysulfanylphenoxy)-N-(1-methylpyrazol-3-yl)-1-benzofuran-6-carboxamide |
| SMILES | COOSc1ccc(Oc2cc(C(=O)Nc3ccn(C)n3)cc3occc23)cc1 |
| InChI | InChI=1S/C20H17N3O5S/c1-23-9-7-19(22-23)21-20(24)13-11-17-16(8-10-26-17)18(12-13)27-14-3-5-15(6-4-14)29-28-25-2/h3-12H,1-2H3,(H,21,22,24) |
| InChIKey | JKYVXLGZXDYKNU-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 87.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|