C14H14N4O2S — CID 81301403
3-amino-6-methoxy-N-(1-methylpyrazol-3-yl)-1-benzothiophene-2-carboxamide (PubChem CID 81301403) has the molecular formula C14H14N4O2S and a molecular weight of 302.36 g/mol. Its IUPAC name is 3-amino-6-methoxy-N-(1-methylpyrazol-3-yl)-1-benzothiophene-2-carboxamide.
| Compound Name | 3-amino-6-methoxy-N-(1-methylpyrazol-3-yl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 81301403 |
| Molecular Formula | C14H14N4O2S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 3-amino-6-methoxy-N-(1-methylpyrazol-3-yl)-1-benzothiophene-2-carboxamide |
| SMILES | COc1ccc2c(N)c(C(=O)Nc3ccn(C)n3)sc2c1 |
| InChI | InChI=1S/C14H14N4O2S/c1-18-6-5-11(17-18)16-14(19)13-12(15)9-4-3-8(20-2)7-10(9)21-13/h3-7H,15H2,1-2H3,(H,16,17,19) |
| InChIKey | GQVBPVQGDOPLGW-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |