C12H11F2N3OS — CID 18152749
4-(difluoromethylsulfanyl)-N-(1-methylpyrazol-3-yl)benzamide (PubChem CID 18152749) has the molecular formula C12H11F2N3OS and a molecular weight of 283.30 g/mol. Its IUPAC name is 4-(difluoromethylsulfanyl)-N-(1-methylpyrazol-3-yl)benzamide.
| Compound Name | 4-(difluoromethylsulfanyl)-N-(1-methylpyrazol-3-yl)benzamide |
|---|---|
| PubChem CID | 18152749 |
| Molecular Formula | C12H11F2N3OS |
| Molecular Weight | 283.30 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 4-(difluoromethylsulfanyl)-N-(1-methylpyrazol-3-yl)benzamide |
| SMILES | Cn1ccc(NC(=O)c2ccc(SC(F)F)cc2)n1 |
| InChI | InChI=1S/C12H11F2N3OS/c1-17-7-6-10(16-17)15-11(18)8-2-4-9(5-3-8)19-12(13)14/h2-7,12H,1H3,(H,15,16,18) |
| InChIKey | MZBOTQDPWJXGEU-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.30 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |