C24H26FN3O4 — CID 58146838
4-[(5-fluoro-2-adamantyl)amino]-5-nitro-6-(2-phenylethyl)pyridine-3-carboxylic acid (PubChem CID 58146838) has the molecular formula C24H26FN3O4 and a molecular weight of 439.49 g/mol. Its IUPAC name is 4-[(5-fluoro-2-adamantyl)amino]-5-nitro-6-(2-phenylethyl)pyridine-3-carboxylic acid.
| Compound Name | 4-[(5-fluoro-2-adamantyl)amino]-5-nitro-6-(2-phenylethyl)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 58146838 |
| Molecular Formula | C24H26FN3O4 |
| Molecular Weight | 439.49 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | 4-[(5-fluoro-2-adamantyl)amino]-5-nitro-6-(2-phenylethyl)pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cnc(CCc2ccccc2)c([N+](=O)[O-])c1NC1C2CC3CC1CC(F)(C3)C2 |
| InChI | InChI=1S/C24H26FN3O4/c25-24-10-15-8-16(11-24)20(17(9-15)12-24)27-21-18(23(29)30)13-26-19(22(21)28(31)32)7-6-14-4-2-1-3-5-14/h1-5,13,15-17,20H,6-12H2,(H,26,27)(H,29,30) |
| InChIKey | MNCXDVGCJSHEKM-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 105.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.49 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|