C21H25FN2O2 — CID 58146847
ethyl 4-[(5-fluoro-2-adamantyl)amino]-7H-cyclopenta[b]pyridine-3-carboxylate (PubChem CID 58146847) has the molecular formula C21H25FN2O2 and a molecular weight of 356.44 g/mol. Its IUPAC name is ethyl 4-[(5-fluoro-2-adamantyl)amino]-7H-cyclopenta[b]pyridine-3-carboxylate.
| Compound Name | ethyl 4-[(5-fluoro-2-adamantyl)amino]-7H-cyclopenta[b]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 58146847 |
| Molecular Formula | C21H25FN2O2 |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | ethyl 4-[(5-fluoro-2-adamantyl)amino]-7H-cyclopenta[b]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2c(c1NC1C3CC4CC1CC(F)(C4)C3)C=CC2 |
| InChI | InChI=1S/C21H25FN2O2/c1-2-26-20(25)16-11-23-17-5-3-4-15(17)19(16)24-18-13-6-12-7-14(18)10-21(22,8-12)9-13/h3-4,11-14,18H,2,5-10H2,1H3,(H,23,24) |
| InChIKey | KHNGHFVVFAJKLU-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |