C18H17ClF3NO2 — CID 58148141
2-(5-tert-butyl-2-hydroxyphenyl)-1-[2-chloro-5-(trifluoromethyl)-4-pyridinyl]ethanone (PubChem CID 58148141) has the molecular formula C18H17ClF3NO2 and a molecular weight of 371.79 g/mol. Its IUPAC name is 2-(5-tert-butyl-2-hydroxyphenyl)-1-[2-chloro-5-(trifluoromethyl)-4-pyridinyl]ethanone.
| Compound Name | 2-(5-tert-butyl-2-hydroxyphenyl)-1-[2-chloro-5-(trifluoromethyl)-4-pyridinyl]ethanone |
|---|---|
| PubChem CID | 58148141 |
| Molecular Formula | C18H17ClF3NO2 |
| Molecular Weight | 371.79 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | 2-(5-tert-butyl-2-hydroxyphenyl)-1-[2-chloro-5-(trifluoromethyl)-4-pyridinyl]ethanone |
| SMILES | CC(C)(C)c1ccc(O)c(CC(=O)c2cc(Cl)ncc2C(F)(F)F)c1 |
| InChI | InChI=1S/C18H17ClF3NO2/c1-17(2,3)11-4-5-14(24)10(6-11)7-15(25)12-8-16(19)23-9-13(12)18(20,21)22/h4-6,8-9,24H,7H2,1-3H3 |
| InChIKey | SRZIBNBJXPZLBI-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.79 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|