C14H11ClFNO2 — CID 58148225
2-(4-chloro-2-hydroxy-5-methylphenyl)-1-(3-fluoro-4-pyridinyl)ethanone (PubChem CID 58148225) has the molecular formula C14H11ClFNO2 and a molecular weight of 279.70 g/mol. Its IUPAC name is 2-(4-chloro-2-hydroxy-5-methylphenyl)-1-(3-fluoro-4-pyridinyl)ethanone.
| Compound Name | 2-(4-chloro-2-hydroxy-5-methylphenyl)-1-(3-fluoro-4-pyridinyl)ethanone |
|---|---|
| PubChem CID | 58148225 |
| Molecular Formula | C14H11ClFNO2 |
| Molecular Weight | 279.70 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | 2-(4-chloro-2-hydroxy-5-methylphenyl)-1-(3-fluoro-4-pyridinyl)ethanone |
| SMILES | Cc1cc(CC(=O)c2ccncc2F)c(O)cc1Cl |
| InChI | InChI=1S/C14H11ClFNO2/c1-8-4-9(13(18)6-11(8)15)5-14(19)10-2-3-17-7-12(10)16/h2-4,6-7,18H,5H2,1H3 |
| InChIKey | VKNGARGZTZCCOC-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.70 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |