C49H67N5O6 — CID 58150955
2-ethylhexyl 4-[[4,6-bis[4-(2-ethylhexoxycarbonyl)anilino]-1,3,5-triazin-2-yl]methyl]benzoate (PubChem CID 58150955) has the molecular formula C49H67N5O6 and a molecular weight of 822.10 g/mol. Its IUPAC name is 2-ethylhexyl 4-[[4,6-bis[4-(2-ethylhexoxycarbonyl)anilino]-1,3,5-triazin-2-yl]methyl]benzoate.
| Compound Name | 2-ethylhexyl 4-[[4,6-bis[4-(2-ethylhexoxycarbonyl)anilino]-1,3,5-triazin-2-yl]methyl]benzoate |
|---|---|
| PubChem CID | 58150955 |
| Molecular Formula | C49H67N5O6 |
| Molecular Weight | 822.10 g/mol |
| Exact Mass | 821.51 |
| IUPAC Name | 2-ethylhexyl 4-[[4,6-bis[4-(2-ethylhexoxycarbonyl)anilino]-1,3,5-triazin-2-yl]methyl]benzoate |
| SMILES | CCCCC(CC)COC(=O)c1ccc(Cc2nc(Nc3ccc(C(=O)OCC(CC)CCCC)cc3)nc(Nc3ccc(C(=O)OCC(CC)CCCC)cc3)n2)cc1 |
| InChI | InChI=1S/C49H67N5O6/c1-7-13-16-35(10-4)32-58-45(55)39-21-19-38(20-22-39)31-44-52-48(50-42-27-23-40(24-28-42)46(56)59-33-36(11-5)17-14-8-2)54-49(53-44)51-43-29-25-41(26-30-43)47(57)60-34-37(12-6)18-15-9-3/h19-30,35-37H,7-18,31-34H2,1-6H3,(H2,50,51,52,53,54) |
| InChIKey | YLMPFWILYDUYKH-UHFFFAOYSA-N |
| XLogP | 12.07 |
| TPSA | 141.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.10 |
| LogP ≤ 5 | 12.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|