C10H20O6Si2 — CID 58151786
[acetyloxy-[2-[acetyloxy(dimethyl)silyl]ethyl]silyl] acetate (PubChem CID 58151786) has the molecular formula C10H20O6Si2 and a molecular weight of 292.44 g/mol. Its IUPAC name is [acetyloxy-[2-[acetyloxy(dimethyl)silyl]ethyl]silyl] acetate.
| Compound Name | [acetyloxy-[2-[acetyloxy(dimethyl)silyl]ethyl]silyl] acetate |
|---|---|
| PubChem CID | 58151786 |
| Molecular Formula | C10H20O6Si2 |
| Molecular Weight | 292.44 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | [acetyloxy-[2-[acetyloxy(dimethyl)silyl]ethyl]silyl] acetate |
| SMILES | CC(=O)O[SiH](CC[Si](C)(C)OC(C)=O)OC(C)=O |
| InChI | InChI=1S/C10H20O6Si2/c1-8(11)14-17(15-9(2)12)6-7-18(4,5)16-10(3)13/h17H,6-7H2,1-5H3 |
| InChIKey | KIDUTSITNSENTQ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.44 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|