C23H23N3O3S — CID 58152183
[3-cyano-2-[(E)-2-oxo-4-pyridin-3-ylbut-3-enyl]-4,5,6,7-tetrahydro-1-benzothiophen-6-yl] N-cyclobutylcarbamate (PubChem CID 58152183) has the molecular formula C23H23N3O3S and a molecular weight of 421.52 g/mol. Its IUPAC name is [3-cyano-2-[(E)-2-oxo-4-pyridin-3-ylbut-3-enyl]-4,5,6,7-tetrahydro-1-benzothiophen-6-yl] N-cyclobutylcarbamate.
| Compound Name | [3-cyano-2-[(E)-2-oxo-4-pyridin-3-ylbut-3-enyl]-4,5,6,7-tetrahydro-1-benzothiophen-6-yl] N-cyclobutylcarbamate |
|---|---|
| PubChem CID | 58152183 |
| Molecular Formula | C23H23N3O3S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | [3-cyano-2-[(E)-2-oxo-4-pyridin-3-ylbut-3-enyl]-4,5,6,7-tetrahydro-1-benzothiophen-6-yl] N-cyclobutylcarbamate |
| SMILES | N#Cc1c(CC(=O)/C=C/c2cccnc2)sc2c1CCC(OC(=O)NC1CCC1)C2 |
| InChI | InChI=1S/C23H23N3O3S/c24-13-20-19-9-8-18(29-23(28)26-16-4-1-5-16)12-22(19)30-21(20)11-17(27)7-6-15-3-2-10-25-14-15/h2-3,6-7,10,14,16,18H,1,4-5,8-9,11-12H2,(H,26,28)/b7-6+ |
| InChIKey | YXMKZVCIZWANCA-VOTSOKGWSA-N |
| XLogP | 3.98 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|