C24H25N3O3S — CID 58152248
[3-cyano-2-[(E)-2-oxo-4-pyridin-3-ylbut-3-enyl]-4,5,6,7-tetrahydro-1-benzothiophen-6-yl] N-cyclopentylcarbamate (PubChem CID 58152248) has the molecular formula C24H25N3O3S and a molecular weight of 435.55 g/mol. Its IUPAC name is [3-cyano-2-[(E)-2-oxo-4-pyridin-3-ylbut-3-enyl]-4,5,6,7-tetrahydro-1-benzothiophen-6-yl] N-cyclopentylcarbamate.
| Compound Name | [3-cyano-2-[(E)-2-oxo-4-pyridin-3-ylbut-3-enyl]-4,5,6,7-tetrahydro-1-benzothiophen-6-yl] N-cyclopentylcarbamate |
|---|---|
| PubChem CID | 58152248 |
| Molecular Formula | C24H25N3O3S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | [3-cyano-2-[(E)-2-oxo-4-pyridin-3-ylbut-3-enyl]-4,5,6,7-tetrahydro-1-benzothiophen-6-yl] N-cyclopentylcarbamate |
| SMILES | N#Cc1c(CC(=O)/C=C/c2cccnc2)sc2c1CCC(OC(=O)NC1CCCC1)C2 |
| InChI | InChI=1S/C24H25N3O3S/c25-14-21-20-10-9-19(30-24(29)27-17-5-1-2-6-17)13-23(20)31-22(21)12-18(28)8-7-16-4-3-11-26-15-16/h3-4,7-8,11,15,17,19H,1-2,5-6,9-10,12-13H2,(H,27,29)/b8-7+ |
| InChIKey | QHMVOQJYEBKXSD-BQYQJAHWSA-N |
| XLogP | 4.37 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|