C13H10ClF3N4O — CID 58155043
3-[[2-chloro-5-(trifluoromethyl)-4-pyridinyl]amino]-N-methylpyridine-4-carboxamide (PubChem CID 58155043) has the molecular formula C13H10ClF3N4O and a molecular weight of 330.70 g/mol. Its IUPAC name is 3-[[2-chloro-5-(trifluoromethyl)-4-pyridinyl]amino]-N-methylpyridine-4-carboxamide.
| Compound Name | 3-[[2-chloro-5-(trifluoromethyl)-4-pyridinyl]amino]-N-methylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 58155043 |
| Molecular Formula | C13H10ClF3N4O |
| Molecular Weight | 330.70 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 3-[[2-chloro-5-(trifluoromethyl)-4-pyridinyl]amino]-N-methylpyridine-4-carboxamide |
| SMILES | CNC(=O)c1ccncc1Nc1cc(Cl)ncc1C(F)(F)F |
| InChI | InChI=1S/C13H10ClF3N4O/c1-18-12(22)7-2-3-19-6-10(7)21-9-4-11(14)20-5-8(9)13(15,16)17/h2-6H,1H3,(H,18,22)(H,20,21) |
| InChIKey | HZECJORHYYLIBI-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.70 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|