C18H20N4O2S — CID 58157269
4-(benzenesulfonyl)-5-ethyl-11-methyl-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraene (PubChem CID 58157269) has the molecular formula C18H20N4O2S and a molecular weight of 356.45 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-5-ethyl-11-methyl-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraene.
| Compound Name | 4-(benzenesulfonyl)-5-ethyl-11-methyl-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraene |
|---|---|
| PubChem CID | 58157269 |
| Molecular Formula | C18H20N4O2S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 4-(benzenesulfonyl)-5-ethyl-11-methyl-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraene |
| SMILES | CCc1nn2cc3c(nc2c1S(=O)(=O)c1ccccc1)CCN(C)C3 |
| InChI | InChI=1S/C18H20N4O2S/c1-3-15-17(25(23,24)14-7-5-4-6-8-14)18-19-16-9-10-21(2)11-13(16)12-22(18)20-15/h4-8,12H,3,9-11H2,1-2H3 |
| InChIKey | JXULWBLTXATVCY-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 67.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |