C17H18Cl2N4O2S — CID 162313973
4-(3-chlorophenyl)sulfonyl-5,11-dimethyl-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraene;hydrochloride (PubChem CID 162313973) has the molecular formula C17H18Cl2N4O2S and a molecular weight of 413.33 g/mol. Its IUPAC name is 4-(3-chlorophenyl)sulfonyl-5,11-dimethyl-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraene;hydrochloride.
| Compound Name | 4-(3-chlorophenyl)sulfonyl-5,11-dimethyl-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraene;hydrochloride |
|---|---|
| PubChem CID | 162313973 |
| Molecular Formula | C17H18Cl2N4O2S |
| Molecular Weight | 413.33 g/mol |
| Exact Mass | 412.05 |
| IUPAC Name | 4-(3-chlorophenyl)sulfonyl-5,11-dimethyl-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraene;hydrochloride |
| SMILES | Cc1nn2cc3c(nc2c1S(=O)(=O)c1cccc(Cl)c1)CCN(C)C3.Cl |
| InChI | InChI=1S/C17H17ClN4O2S.ClH/c1-11-16(25(23,24)14-5-3-4-13(18)8-14)17-19-15-6-7-21(2)9-12(15)10-22(17)20-11;/h3-5,8,10H,6-7,9H2,1-2H3;1H |
| InChIKey | KDCMAEURXPASLS-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 67.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.33 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |