C19H20ClN5O2S — CID 90320826
5-(3-chlorophenyl)sulfonyl-N-ethenyl-8,11-dimethyl-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-4-amine (PubChem CID 90320826) has the molecular formula C19H20ClN5O2S and a molecular weight of 417.92 g/mol. Its IUPAC name is 5-(3-chlorophenyl)sulfonyl-N-ethenyl-8,11-dimethyl-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-4-amine.
| Compound Name | 5-(3-chlorophenyl)sulfonyl-N-ethenyl-8,11-dimethyl-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-4-amine |
|---|---|
| PubChem CID | 90320826 |
| Molecular Formula | C19H20ClN5O2S |
| Molecular Weight | 417.92 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | 5-(3-chlorophenyl)sulfonyl-N-ethenyl-8,11-dimethyl-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-4-amine |
| SMILES | C=CNc1nn2c3c(c(C)nc2c1S(=O)(=O)c1cccc(Cl)c1)CN(C)CC3 |
| InChI | InChI=1S/C19H20ClN5O2S/c1-4-21-18-17(28(26,27)14-7-5-6-13(20)10-14)19-22-12(2)15-11-24(3)9-8-16(15)25(19)23-18/h4-7,10H,1,8-9,11H2,2-3H3,(H,21,23) |
| InChIKey | OQHIKTZJZIORHF-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.92 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |