C24H29N5S — CID 143890076
(3Z)-hexa-1,3,5-triene;N,8,11-trimethyl-5-phenylsulfanyl-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-4-amine (PubChem CID 143890076) has the molecular formula C24H29N5S and a molecular weight of 419.60 g/mol. Its IUPAC name is (3Z)-hexa-1,3,5-triene;N,8,11-trimethyl-5-phenylsulfanyl-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-4-amine.
| Compound Name | (3Z)-hexa-1,3,5-triene;N,8,11-trimethyl-5-phenylsulfanyl-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-4-amine |
|---|---|
| PubChem CID | 143890076 |
| Molecular Formula | C24H29N5S |
| Molecular Weight | 419.60 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | (3Z)-hexa-1,3,5-triene;N,8,11-trimethyl-5-phenylsulfanyl-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-4-amine |
| SMILES | C=C/C=C\C=C.CNc1nn2c3c(c(C)nc2c1Sc1ccccc1)CN(C)CC3 |
| InChI | InChI=1S/C18H21N5S.C6H8/c1-12-14-11-22(3)10-9-15(14)23-18(20-12)16(17(19-2)21-23)24-13-7-5-4-6-8-13;1-3-5-6-4-2/h4-8H,9-11H2,1-3H3,(H,19,21);3-6H,1-2H2/b;6-5- |
| InChIKey | SOJMWTBYFOMIPZ-JXGYXAOLSA-N |
| XLogP | 5.13 |
| TPSA | 45.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.60 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|