C21H23ClN4O2S — CID 140652299
4-(3-chlorophenyl)sulfonyl-N-methyl-8-(4-methylpiperazin-1-yl)quinolin-3-amine (PubChem CID 140652299) has the molecular formula C21H23ClN4O2S and a molecular weight of 430.96 g/mol. Its IUPAC name is 4-(3-chlorophenyl)sulfonyl-N-methyl-8-(4-methylpiperazin-1-yl)quinolin-3-amine.
| Compound Name | 4-(3-chlorophenyl)sulfonyl-N-methyl-8-(4-methylpiperazin-1-yl)quinolin-3-amine |
|---|---|
| PubChem CID | 140652299 |
| Molecular Formula | C21H23ClN4O2S |
| Molecular Weight | 430.96 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | 4-(3-chlorophenyl)sulfonyl-N-methyl-8-(4-methylpiperazin-1-yl)quinolin-3-amine |
| SMILES | CNc1cnc2c(N3CCN(C)CC3)cccc2c1S(=O)(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C21H23ClN4O2S/c1-23-18-14-24-20-17(7-4-8-19(20)26-11-9-25(2)10-12-26)21(18)29(27,28)16-6-3-5-15(22)13-16/h3-8,13-14,23H,9-12H2,1-2H3 |
| InChIKey | ALPPPFDRHUNGNH-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.96 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |