C18H22BClN2O3S — CID 20689423
[4-[[6-(3-chlorophenyl)sulfonyl-3-pyridinyl]methyl]piperidin-1-yl]-methylborinic acid (PubChem CID 20689423) has the molecular formula C18H22BClN2O3S and a molecular weight of 392.72 g/mol. Its IUPAC name is [4-[[6-(3-chlorophenyl)sulfonyl-3-pyridinyl]methyl]piperidin-1-yl]-methylborinic acid.
| Compound Name | [4-[[6-(3-chlorophenyl)sulfonyl-3-pyridinyl]methyl]piperidin-1-yl]-methylborinic acid |
|---|---|
| PubChem CID | 20689423 |
| Molecular Formula | C18H22BClN2O3S |
| Molecular Weight | 392.72 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | [4-[[6-(3-chlorophenyl)sulfonyl-3-pyridinyl]methyl]piperidin-1-yl]-methylborinic acid |
| SMILES | CB(O)N1CCC(Cc2ccc(S(=O)(=O)c3cccc(Cl)c3)nc2)CC1 |
| InChI | InChI=1S/C18H22BClN2O3S/c1-19(23)22-9-7-14(8-10-22)11-15-5-6-18(21-13-15)26(24,25)17-4-2-3-16(20)12-17/h2-6,12-14,23H,7-11H2,1H3 |
| InChIKey | DEQXVPWYVRZZIA-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.72 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|