C30H35ClN4O3S — CID 10303331
[4-[4-[[4-(3-chlorophenyl)sulfonylphenyl]methyl]piperidin-1-yl]piperidin-1-yl]-(2,3-diaminophenyl)methanone (PubChem CID 10303331) has the molecular formula C30H35ClN4O3S and a molecular weight of 567.16 g/mol. Its IUPAC name is [4-[4-[[4-(3-chlorophenyl)sulfonylphenyl]methyl]piperidin-1-yl]piperidin-1-yl]-(2,3-diaminophenyl)methanone.
| Compound Name | [4-[4-[[4-(3-chlorophenyl)sulfonylphenyl]methyl]piperidin-1-yl]piperidin-1-yl]-(2,3-diaminophenyl)methanone |
|---|---|
| PubChem CID | 10303331 |
| Molecular Formula | C30H35ClN4O3S |
| Molecular Weight | 567.16 g/mol |
| Exact Mass | 566.21 |
| IUPAC Name | [4-[4-[[4-(3-chlorophenyl)sulfonylphenyl]methyl]piperidin-1-yl]piperidin-1-yl]-(2,3-diaminophenyl)methanone |
| SMILES | Nc1cccc(C(=O)N2CCC(N3CCC(Cc4ccc(S(=O)(=O)c5cccc(Cl)c5)cc4)CC3)CC2)c1N |
| InChI | InChI=1S/C30H35ClN4O3S/c31-23-3-1-4-26(20-23)39(37,38)25-9-7-21(8-10-25)19-22-11-15-34(16-12-22)24-13-17-35(18-14-24)30(36)27-5-2-6-28(32)29(27)33/h1-10,20,22,24H,11-19,32-33H2 |
| InChIKey | FFSWELGSNFXDJV-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 109.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.16 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|