C22H30BN5O2 — CID 170520137
[4-[(4-amino-6-methoxyimino-5,5-dimethylbenzo[h]quinazolin-8-yl)methyl]piperidin-1-yl]-methylborinic acid (PubChem CID 170520137) has the molecular formula C22H30BN5O2 and a molecular weight of 407.33 g/mol. Its IUPAC name is [4-[(4-amino-6-methoxyimino-5,5-dimethylbenzo[h]quinazolin-8-yl)methyl]piperidin-1-yl]-methylborinic acid.
| Compound Name | [4-[(4-amino-6-methoxyimino-5,5-dimethylbenzo[h]quinazolin-8-yl)methyl]piperidin-1-yl]-methylborinic acid |
|---|---|
| PubChem CID | 170520137 |
| Molecular Formula | C22H30BN5O2 |
| Molecular Weight | 407.33 g/mol |
| Exact Mass | 407.25 |
| IUPAC Name | [4-[(4-amino-6-methoxyimino-5,5-dimethylbenzo[h]quinazolin-8-yl)methyl]piperidin-1-yl]-methylborinic acid |
| SMILES | CON=C1c2cc(CC3CCN(B(C)O)CC3)ccc2-c2ncnc(N)c2C1(C)C |
| InChI | InChI=1S/C22H30BN5O2/c1-22(2)18-19(25-13-26-21(18)24)16-6-5-15(12-17(16)20(22)27-30-4)11-14-7-9-28(10-8-14)23(3)29/h5-6,12-14,29H,7-11H2,1-4H3,(H2,24,25,26) |
| InChIKey | OENHPZVTDPDRNT-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.33 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|