About spiro[6H-benzo[h]quinazoline-5,1'-cyclohexane]-4-amine
spiro[6H-benzo[h]quinazoline-5,1'-cyclohexane]-4-amine (PubChem CID 834226) has the molecular formula C17H19N3
and a molecular weight of 265.36 g/mol. Its IUPAC name is spiro[6H-benzo[h]quinazoline-5,1'-cyclohexane]-4-amine.
Molecular Properties
| Compound Name | spiro[6H-benzo[h]quinazoline-5,1'-cyclohexane]-4-amine |
| PubChem CID | 834226 |
| Molecular Formula | C17H19N3 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | spiro[6H-benzo[h]quinazoline-5,1'-cyclohexane]-4-amine |
| SMILES | Nc1ncnc2c1C1(CCCCC1)Cc1ccccc1-2 |
| InChI | InChI=1S/C17H19N3/c18-16-14-15(19-11-20-16)13-7-3-2-6-12(13)10-17(14)8-4-1-5-9-17/h2-3,6-7,11H,1,4-5,8-10H2,(H2,18,19,20) |
| InChIKey | GLSZFCWQUSHZNG-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze spiro[6H-benzo[h]quinazoline-5,1'-cyclohexane]-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[6H-benzo[h]quinazoline-5,1'-cyclohexane]-4-amine?
The IUPAC name of spiro[6H-benzo[h]quinazoline-5,1'-cyclohexane]-4-amine (CID 834226) is spiro[6H-benzo[h]quinazoline-5,1'-cyclohexane]-4-amine.
What is the SMILES notation for spiro[6H-benzo[h]quinazoline-5,1'-cyclohexane]-4-amine?
The canonical SMILES for spiro[6H-benzo[h]quinazoline-5,1'-cyclohexane]-4-amine is Nc1ncnc2c1C1(CCCCC1)Cc1ccccc1-2.
What is the InChIKey of spiro[6H-benzo[h]quinazoline-5,1'-cyclohexane]-4-amine?
The InChIKey is GLSZFCWQUSHZNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N3/c18-16-14-15(19-11-20-16)13-7-3-2-6-12(13)10-17(14)8-4-1-5-9-17/h2-3,6-7,11H,1,4-5,8-10H2,(H2,18,19,20).
What are the key properties of spiro[6H-benzo[h]quinazoline-5,1'-cyclohexane]-4-amine?
spiro[6H-benzo[h]quinazoline-5,1'-cyclohexane]-4-amine has a molecular weight of 265.36 g/mol, XLogP of 3.48, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[6H-benzo[h]quinazoline-5,1'-cyclohexane]-4-amine is sourced from PubChem (CID 834226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).