C17H19N3 — CID 834226
spiro[6H-benzo[h]quinazoline-5,1'-cyclohexane]-4-amine (PubChem CID 834226) has the molecular formula C17H19N3 and a molecular weight of 265.36 g/mol. Its IUPAC name is spiro[6H-benzo[h]quinazoline-5,1'-cyclohexane]-4-amine.
| Compound Name | spiro[6H-benzo[h]quinazoline-5,1'-cyclohexane]-4-amine |
|---|---|
| PubChem CID | 834226 |
| Molecular Formula | C17H19N3 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | spiro[6H-benzo[h]quinazoline-5,1'-cyclohexane]-4-amine |
| SMILES | Nc1ncnc2c1C1(CCCCC1)Cc1ccccc1-2 |
| InChI | InChI=1S/C17H19N3/c18-16-14-15(19-11-20-16)13-7-3-2-6-12(13)10-17(14)8-4-1-5-9-17/h2-3,6-7,11H,1,4-5,8-10H2,(H2,18,19,20) |
| InChIKey | GLSZFCWQUSHZNG-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |