About 2-[5-tert-butyl-3-(2,2,2-trifluoroethoxy)pyrazol-1-yl]-3-chloropyridine
2-[5-tert-butyl-3-(2,2,2-trifluoroethoxy)pyrazol-1-yl]-3-chloropyridine (PubChem CID 58157408) has the molecular formula C14H15ClF3N3O
and a molecular weight of 333.74 g/mol. Its IUPAC name is 2-[5-tert-butyl-3-(2,2,2-trifluoroethoxy)pyrazol-1-yl]-3-chloropyridine.
Molecular Properties
| Compound Name | 2-[5-tert-butyl-3-(2,2,2-trifluoroethoxy)pyrazol-1-yl]-3-chloropyridine |
| PubChem CID | 58157408 |
| Molecular Formula | C14H15ClF3N3O |
| Molecular Weight | 333.74 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 2-[5-tert-butyl-3-(2,2,2-trifluoroethoxy)pyrazol-1-yl]-3-chloropyridine |
| SMILES | CC(C)(C)c1cc(OCC(F)(F)F)nn1-c1ncccc1Cl |
| InChI | InChI=1S/C14H15ClF3N3O/c1-13(2,3)10-7-11(22-8-14(16,17)18)20-21(10)12-9(15)5-4-6-19-12/h4-7H,8H2,1-3H3 |
| InChIKey | FUPHXFMMWPLMSR-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.74 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[5-tert-butyl-3-(2,2,2-trifluoroethoxy)pyrazol-1-yl]-3-chloropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-tert-butyl-3-(2,2,2-trifluoroethoxy)pyrazol-1-yl]-3-chloropyridine?
The IUPAC name of 2-[5-tert-butyl-3-(2,2,2-trifluoroethoxy)pyrazol-1-yl]-3-chloropyridine (CID 58157408) is 2-[5-tert-butyl-3-(2,2,2-trifluoroethoxy)pyrazol-1-yl]-3-chloropyridine.
What is the SMILES notation for 2-[5-tert-butyl-3-(2,2,2-trifluoroethoxy)pyrazol-1-yl]-3-chloropyridine?
The canonical SMILES for 2-[5-tert-butyl-3-(2,2,2-trifluoroethoxy)pyrazol-1-yl]-3-chloropyridine is CC(C)(C)c1cc(OCC(F)(F)F)nn1-c1ncccc1Cl.
What is the InChIKey of 2-[5-tert-butyl-3-(2,2,2-trifluoroethoxy)pyrazol-1-yl]-3-chloropyridine?
The InChIKey is FUPHXFMMWPLMSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15ClF3N3O/c1-13(2,3)10-7-11(22-8-14(16,17)18)20-21(10)12-9(15)5-4-6-19-12/h4-7H,8H2,1-3H3.
What are the key properties of 2-[5-tert-butyl-3-(2,2,2-trifluoroethoxy)pyrazol-1-yl]-3-chloropyridine?
2-[5-tert-butyl-3-(2,2,2-trifluoroethoxy)pyrazol-1-yl]-3-chloropyridine has a molecular weight of 333.74 g/mol, XLogP of 4.16, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-tert-butyl-3-(2,2,2-trifluoroethoxy)pyrazol-1-yl]-3-chloropyridine is sourced from PubChem (CID 58157408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).