C30H25N3O — CID 58159652
6-[3-(6-ethylpyrimidin-4-yl)-5-(4-methoxyphenyl)-3H-inden-1-yl]-1H-indole (PubChem CID 58159652) has the molecular formula C30H25N3O and a molecular weight of 443.55 g/mol. Its IUPAC name is 6-[3-(6-ethylpyrimidin-4-yl)-5-(4-methoxyphenyl)-3H-inden-1-yl]-1H-indole.
| Compound Name | 6-[3-(6-ethylpyrimidin-4-yl)-5-(4-methoxyphenyl)-3H-inden-1-yl]-1H-indole |
|---|---|
| PubChem CID | 58159652 |
| Molecular Formula | C30H25N3O |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | 6-[3-(6-ethylpyrimidin-4-yl)-5-(4-methoxyphenyl)-3H-inden-1-yl]-1H-indole |
| SMILES | CCc1cc(C2C=C(c3ccc4cc[nH]c4c3)c3ccc(-c4ccc(OC)cc4)cc32)ncn1 |
| InChI | InChI=1S/C30H25N3O/c1-3-23-16-30(33-18-32-23)28-17-26(22-5-4-20-12-13-31-29(20)15-22)25-11-8-21(14-27(25)28)19-6-9-24(34-2)10-7-19/h4-18,28,31H,3H2,1-2H3 |
| InChIKey | MDGXKSNNDFCGRC-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |