C70H48N2S2 — CID 58161036
4-[2,3-diphenyl-1-(4-phenylphenyl)indol-5-yl]-N,N-bis[4-(5-phenylthiophen-2-yl)phenyl]aniline (PubChem CID 58161036) has the molecular formula C70H48N2S2 and a molecular weight of 981.30 g/mol. Its IUPAC name is 4-[2,3-diphenyl-1-(4-phenylphenyl)indol-5-yl]-N,N-bis[4-(5-phenylthiophen-2-yl)phenyl]aniline.
| Compound Name | 4-[2,3-diphenyl-1-(4-phenylphenyl)indol-5-yl]-N,N-bis[4-(5-phenylthiophen-2-yl)phenyl]aniline |
|---|---|
| PubChem CID | 58161036 |
| Molecular Formula | C70H48N2S2 |
| Molecular Weight | 981.30 g/mol |
| Exact Mass | 980.33 |
| IUPAC Name | 4-[2,3-diphenyl-1-(4-phenylphenyl)indol-5-yl]-N,N-bis[4-(5-phenylthiophen-2-yl)phenyl]aniline |
| SMILES | c1ccc(-c2ccc(-n3c(-c4ccccc4)c(-c4ccccc4)c4cc(-c5ccc(N(c6ccc(-c7ccc(-c8ccccc8)s7)cc6)c6ccc(-c7ccc(-c8ccccc8)s7)cc6)cc5)ccc43)cc2)cc1 |
| InChI | InChI=1S/C70H48N2S2/c1-6-16-49(17-7-1)50-26-37-62(38-27-50)72-64-43-34-58(48-63(64)69(56-22-12-4-13-23-56)70(72)57-24-14-5-15-25-57)51-28-35-59(36-29-51)71(60-39-30-54(31-40-60)67-46-44-65(73-67)52-18-8-2-9-19-52)61-41-32-55(33-42-61)68-47-45-66(74-68)53-20-10-3-11-21-53/h1-48H |
| InChIKey | BJCXUESBEWXXLY-UHFFFAOYSA-N |
| XLogP | 20.56 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 981.30 |
| LogP ≤ 5 | 20.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |