C53H52N2 — CID 58161207
N-[4-(5,10-ditert-butyl-2,3-dimethylnaphtho[2,3-f]indol-1-yl)phenyl]-9,9-dimethyl-N-phenylfluoren-3-amine (PubChem CID 58161207) has the molecular formula C53H52N2 and a molecular weight of 717.01 g/mol. Its IUPAC name is N-[4-(5,10-ditert-butyl-2,3-dimethylnaphtho[2,3-f]indol-1-yl)phenyl]-9,9-dimethyl-N-phenylfluoren-3-amine.
| Compound Name | N-[4-(5,10-ditert-butyl-2,3-dimethylnaphtho[2,3-f]indol-1-yl)phenyl]-9,9-dimethyl-N-phenylfluoren-3-amine |
|---|---|
| PubChem CID | 58161207 |
| Molecular Formula | C53H52N2 |
| Molecular Weight | 717.01 g/mol |
| Exact Mass | 716.41 |
| IUPAC Name | N-[4-(5,10-ditert-butyl-2,3-dimethylnaphtho[2,3-f]indol-1-yl)phenyl]-9,9-dimethyl-N-phenylfluoren-3-amine |
| SMILES | Cc1c(C)n(-c2ccc(N(c3ccccc3)c3ccc4c(c3)-c3ccccc3C4(C)C)cc2)c2cc3c(C(C)(C)C)c4ccccc4c(C(C)(C)C)c3cc12 |
| InChI | InChI=1S/C53H52N2/c1-33-34(2)54(48-32-45-44(31-42(33)48)49(51(3,4)5)40-21-14-15-22-41(40)50(45)52(6,7)8)36-24-26-37(27-25-36)55(35-18-12-11-13-19-35)38-28-29-47-43(30-38)39-20-16-17-23-46(39)53(47,9)10/h11-32H,1-10H3 |
| InChIKey | UIGNOFUSNAZOLG-UHFFFAOYSA-N |
| XLogP | 14.92 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.01 |
| LogP ≤ 5 | 14.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|