C54H44N2 — CID 58161447
3,13-bis(9,9-dimethylfluoren-2-yl)-4,5,14,15-tetramethyl-3,13-diazahexacyclo[9.9.2.02,6.08,21.012,16.018,22]docosa-1(21),2(6),4,7,9,11(22),12(16),14,17,19-decaene (PubChem CID 58161447) has the molecular formula C54H44N2 and a molecular weight of 720.96 g/mol. Its IUPAC name is 3,13-bis(9,9-dimethylfluoren-2-yl)-4,5,14,15-tetramethyl-3,13-diazahexacyclo[9.9.2.02,6.08,21.012,16.018,22]docosa-1(21),2(6),4,7,9,11(22),12(16),14,17,19-decaene.
| Compound Name | 3,13-bis(9,9-dimethylfluoren-2-yl)-4,5,14,15-tetramethyl-3,13-diazahexacyclo[9.9.2.02,6.08,21.012,16.018,22]docosa-1(21),2(6),4,7,9,11(22),12(16),14,17,19-decaene |
|---|---|
| PubChem CID | 58161447 |
| Molecular Formula | C54H44N2 |
| Molecular Weight | 720.96 g/mol |
| Exact Mass | 720.35 |
| IUPAC Name | 3,13-bis(9,9-dimethylfluoren-2-yl)-4,5,14,15-tetramethyl-3,13-diazahexacyclo[9.9.2.02,6.08,21.012,16.018,22]docosa-1(21),2(6),4,7,9,11(22),12(16),14,17,19-decaene |
| SMILES | Cc1c(C)n(-c2ccc3c(c2)C(C)(C)c2ccccc2-3)c2c1cc1ccc3c4c(ccc2c14)cc1c(C)c(C)n(-c2ccc4c(c2)C(C)(C)c2ccccc2-4)c13 |
| InChI | InChI=1S/C54H44N2/c1-29-31(3)55(35-19-23-39-37-13-9-11-15-45(37)53(5,6)47(39)27-35)51-41-21-18-34-26-44-30(2)32(4)56(52(44)42-22-17-33(25-43(29)51)49(41)50(34)42)36-20-24-40-38-14-10-12-16-46(38)54(7,8)48(40)28-36/h9-28H,1-8H3 |
| InChIKey | ZXGFFBLXMKJPGJ-UHFFFAOYSA-N |
| XLogP | 14.32 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.96 |
| LogP ≤ 5 | 14.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|